About (2Z,4E)-2-cyano-5-(dimethylamino)-5-(4-methylphenyl)penta-2,4-dienethioamide
(2Z,4E)-2-cyano-5-(dimethylamino)-5-(4-methylphenyl)penta-2,4-dienethioamide (PubChem CID 134867553) has the molecular formula C15H17N3S
and a molecular weight of 271.39 g/mol. Its IUPAC name is (2Z,4E)-2-cyano-5-(dimethylamino)-5-(4-methylphenyl)penta-2,4-dienethioamide.
Molecular Properties
| Compound Name | (2Z,4E)-2-cyano-5-(dimethylamino)-5-(4-methylphenyl)penta-2,4-dienethioamide |
| PubChem CID | 134867553 |
| Molecular Formula | C15H17N3S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | (2Z,4E)-2-cyano-5-(dimethylamino)-5-(4-methylphenyl)penta-2,4-dienethioamide |
| SMILES | Cc1ccc(/C(=C\C=C(\C#N)C(N)=S)N(C)C)cc1 |
| InChI | InChI=1S/C15H17N3S/c1-11-4-6-12(7-5-11)14(18(2)3)9-8-13(10-16)15(17)19/h4-9H,1-3H3,(H2,17,19)/b13-8-,14-9+ |
| InChIKey | MUKBLEJMGNJZAR-NBPWYHHBSA-N |
| XLogP | 2.63 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-2-cyano-5-(dimethylamino)-5-(4-methylphenyl)penta-2,4-dienethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-2-cyano-5-(dimethylamino)-5-(4-methylphenyl)penta-2,4-dienethioamide?
The IUPAC name of (2Z,4E)-2-cyano-5-(dimethylamino)-5-(4-methylphenyl)penta-2,4-dienethioamide (CID 134867553) is (2Z,4E)-2-cyano-5-(dimethylamino)-5-(4-methylphenyl)penta-2,4-dienethioamide.
What is the SMILES notation for (2Z,4E)-2-cyano-5-(dimethylamino)-5-(4-methylphenyl)penta-2,4-dienethioamide?
The canonical SMILES for (2Z,4E)-2-cyano-5-(dimethylamino)-5-(4-methylphenyl)penta-2,4-dienethioamide is Cc1ccc(/C(=C\C=C(\C#N)C(N)=S)N(C)C)cc1.
What is the InChIKey of (2Z,4E)-2-cyano-5-(dimethylamino)-5-(4-methylphenyl)penta-2,4-dienethioamide?
The InChIKey is MUKBLEJMGNJZAR-NBPWYHHBSA-N. The full InChI is InChI=1S/C15H17N3S/c1-11-4-6-12(7-5-11)14(18(2)3)9-8-13(10-16)15(17)19/h4-9H,1-3H3,(H2,17,19)/b13-8-,14-9+.
What are the key properties of (2Z,4E)-2-cyano-5-(dimethylamino)-5-(4-methylphenyl)penta-2,4-dienethioamide?
(2Z,4E)-2-cyano-5-(dimethylamino)-5-(4-methylphenyl)penta-2,4-dienethioamide has a molecular weight of 271.39 g/mol, XLogP of 2.63, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-2-cyano-5-(dimethylamino)-5-(4-methylphenyl)penta-2,4-dienethioamide is sourced from PubChem (CID 134867553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).