C13H10ClNO2 — CID 92858270
(2E,4E)-5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienoic acid (PubChem CID 92858270) has the molecular formula C13H10ClNO2 and a molecular weight of 247.68 g/mol. Its IUPAC name is (2E,4E)-5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 92858270 |
| Molecular Formula | C13H10ClNO2 |
| Molecular Weight | 247.68 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | (2E,4E)-5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienoic acid |
| SMILES | Cc1ccc(/C(Cl)=C\C=C(/C#N)C(=O)O)cc1 |
| InChI | InChI=1S/C13H10ClNO2/c1-9-2-4-10(5-3-9)12(14)7-6-11(8-15)13(16)17/h2-7H,1H3,(H,16,17)/b11-6+,12-7+ |
| InChIKey | WRLBQYHACWHRRM-GNXRPPCSSA-N |
| XLogP | 3.11 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.68 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|