About (E)-2-cyanobut-2-enamide
(E)-2-cyanobut-2-enamide (PubChem CID 88621085) has the molecular formula C5H6N2O
and a molecular weight of 110.12 g/mol. Its IUPAC name is (E)-2-cyanobut-2-enamide.
Molecular Properties
| Compound Name | (E)-2-cyanobut-2-enamide |
| PubChem CID | 88621085 |
| Molecular Formula | C5H6N2O |
| Molecular Weight | 110.12 g/mol |
| Exact Mass | 110.05 |
| IUPAC Name | (E)-2-cyanobut-2-enamide |
| SMILES | C/C=C(\C#N)C(N)=O |
| InChI | InChI=1S/C5H6N2O/c1-2-4(3-6)5(7)8/h2H,1H3,(H2,7,8)/b4-2+ |
| InChIKey | SOOVQWISVRVEGT-DUXPYHPUSA-N |
| XLogP | -0.06 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.12 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-cyanobut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-cyanobut-2-enamide?
The IUPAC name of (E)-2-cyanobut-2-enamide (CID 88621085) is (E)-2-cyanobut-2-enamide.
What is the SMILES notation for (E)-2-cyanobut-2-enamide?
The canonical SMILES for (E)-2-cyanobut-2-enamide is C/C=C(\C#N)C(N)=O.
What is the InChIKey of (E)-2-cyanobut-2-enamide?
The InChIKey is SOOVQWISVRVEGT-DUXPYHPUSA-N. The full InChI is InChI=1S/C5H6N2O/c1-2-4(3-6)5(7)8/h2H,1H3,(H2,7,8)/b4-2+.
What are the key properties of (E)-2-cyanobut-2-enamide?
(E)-2-cyanobut-2-enamide has a molecular weight of 110.12 g/mol, XLogP of -0.06, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-cyanobut-2-enamide is sourced from PubChem (CID 88621085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).