About 2-cyanobut-2-enimidamide
2-cyanobut-2-enimidamide (PubChem CID 123857678) has the molecular formula C5H7N3
and a molecular weight of 109.13 g/mol. Its IUPAC name is 2-cyanobut-2-enimidamide.
Molecular Properties
| Compound Name | 2-cyanobut-2-enimidamide |
| PubChem CID | 123857678 |
| Molecular Formula | C5H7N3 |
| Molecular Weight | 109.13 g/mol |
| Exact Mass | 109.06 |
| IUPAC Name | 2-cyanobut-2-enimidamide |
| SMILES | [H]/N=C(\N)C(C#N)=CC |
| InChI | InChI=1S/C5H7N3/c1-2-4(3-6)5(7)8/h2H,1H3,(H3,7,8) |
| InChIKey | CVRJYTQQQCMMGL-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.13 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanobut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanobut-2-enimidamide?
The IUPAC name of 2-cyanobut-2-enimidamide (CID 123857678) is 2-cyanobut-2-enimidamide.
What is the SMILES notation for 2-cyanobut-2-enimidamide?
The canonical SMILES for 2-cyanobut-2-enimidamide is [H]/N=C(\N)C(C#N)=CC.
What is the InChIKey of 2-cyanobut-2-enimidamide?
The InChIKey is CVRJYTQQQCMMGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3/c1-2-4(3-6)5(7)8/h2H,1H3,(H3,7,8).
What are the key properties of 2-cyanobut-2-enimidamide?
2-cyanobut-2-enimidamide has a molecular weight of 109.13 g/mol, XLogP of 0.39, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanobut-2-enimidamide is sourced from PubChem (CID 123857678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).