C12H6F6N2O — CID 137318970
3-[3,5-bis(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide (PubChem CID 137318970) has the molecular formula C12H6F6N2O and a molecular weight of 308.18 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 137318970 |
| Molecular Formula | C12H6F6N2O |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide |
| SMILES | N#CC(=Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(N)=O |
| InChI | InChI=1S/C12H6F6N2O/c13-11(14,15)8-2-6(1-7(5-19)10(20)21)3-9(4-8)12(16,17)18/h1-4H,(H2,20,21) |
| InChIKey | PGZKKYMEBFZCMM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|