C13H10F6O — CID 103090905
4-[3,5-bis(trifluoromethyl)phenyl]-3-methylbut-3-en-2-one (PubChem CID 103090905) has the molecular formula C13H10F6O and a molecular weight of 296.21 g/mol. Its IUPAC name is 4-[3,5-bis(trifluoromethyl)phenyl]-3-methylbut-3-en-2-one.
| Compound Name | 4-[3,5-bis(trifluoromethyl)phenyl]-3-methylbut-3-en-2-one |
|---|---|
| PubChem CID | 103090905 |
| Molecular Formula | C13H10F6O |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 4-[3,5-bis(trifluoromethyl)phenyl]-3-methylbut-3-en-2-one |
| SMILES | CC(=O)C(C)=Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H10F6O/c1-7(8(2)20)3-9-4-10(12(14,15)16)6-11(5-9)13(17,18)19/h3-6H,1-2H3 |
| InChIKey | BRBUIVVRKBYJDA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|