C11H9F3O — CID 103090935
(E)-3-methyl-4-(3,4,5-trifluorophenyl)but-3-en-2-one (PubChem CID 103090935) has the molecular formula C11H9F3O and a molecular weight of 214.19 g/mol. Its IUPAC name is (E)-3-methyl-4-(3,4,5-trifluorophenyl)but-3-en-2-one.
| Compound Name | (E)-3-methyl-4-(3,4,5-trifluorophenyl)but-3-en-2-one |
|---|---|
| PubChem CID | 103090935 |
| Molecular Formula | C11H9F3O |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | (E)-3-methyl-4-(3,4,5-trifluorophenyl)but-3-en-2-one |
| SMILES | CC(=O)/C(C)=C/c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C11H9F3O/c1-6(7(2)15)3-8-4-9(12)11(14)10(13)5-8/h3-5H,1-2H3/b6-3+ |
| InChIKey | RMPJYWHROGUPFT-ZZXKWVIFSA-N |
| XLogP | 3.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|