methyl 3-oxo-2-[(3,4,5-trifluorophenyl)methylidene]butanoate

C12H9F3O3 — CID 54409186

IUPACmethyl 3-oxo-2-[(3,4,5-trifluorophenyl)methylidene]butanoate
SMILESCOC(=O)C(=Cc1cc(F)c(F)c(F)c1)C(C)=O
InChIInChI=1S/C12H9F3O3/c1-6(16)8(12(17)18-2)3-7-4-9(13)11(15)10(14)5-7/h3-5H,1-2H3
InChIKeyVSWXHMZFTSMBDQ-UHFFFAOYSA-N
MW258.19 g/mol
LogP2.25
Rot. Bonds3

About methyl 3-oxo-2-[(3,4,5-trifluorophenyl)methylidene]butanoate

methyl 3-oxo-2-[(3,4,5-trifluorophenyl)methylidene]butanoate (PubChem CID 54409186) has the molecular formula C12H9F3O3 and a molecular weight of 258.19 g/mol. Its IUPAC name is methyl 3-oxo-2-[(3,4,5-trifluorophenyl)methylidene]butanoate.

Molecular Properties

Compound Namemethyl 3-oxo-2-[(3,4,5-trifluorophenyl)methylidene]butanoate
PubChem CID54409186
Molecular FormulaC12H9F3O3
Molecular Weight258.19 g/mol
Exact Mass258.05
IUPAC Namemethyl 3-oxo-2-[(3,4,5-trifluorophenyl)methylidene]butanoate
SMILESCOC(=O)C(=Cc1cc(F)c(F)c(F)c1)C(C)=O
InChIInChI=1S/C12H9F3O3/c1-6(16)8(12(17)18-2)3-7-4-9(13)11(15)10(14)5-7/h3-5H,1-2H3
InChIKeyVSWXHMZFTSMBDQ-UHFFFAOYSA-N
XLogP2.25
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.19
LogP ≤ 52.25
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}

Analyze methyl 3-oxo-2-[(3,4,5-trifluorophenyl)methylidene]butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-oxo-2-[(3,4,5-trifluorophenyl)methylidene]butanoate?
The IUPAC name of methyl 3-oxo-2-[(3,4,5-trifluorophenyl)methylidene]butanoate (CID 54409186) is methyl 3-oxo-2-[(3,4,5-trifluorophenyl)methylidene]butanoate.
What is the SMILES notation for methyl 3-oxo-2-[(3,4,5-trifluorophenyl)methylidene]butanoate?
The canonical SMILES for methyl 3-oxo-2-[(3,4,5-trifluorophenyl)methylidene]butanoate is COC(=O)C(=Cc1cc(F)c(F)c(F)c1)C(C)=O.
What is the InChIKey of methyl 3-oxo-2-[(3,4,5-trifluorophenyl)methylidene]butanoate?
The InChIKey is VSWXHMZFTSMBDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F3O3/c1-6(16)8(12(17)18-2)3-7-4-9(13)11(15)10(14)5-7/h3-5H,1-2H3.
What are the key properties of methyl 3-oxo-2-[(3,4,5-trifluorophenyl)methylidene]butanoate?
methyl 3-oxo-2-[(3,4,5-trifluorophenyl)methylidene]butanoate has a molecular weight of 258.19 g/mol, XLogP of 2.25, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-oxo-2-[(3,4,5-trifluorophenyl)methylidene]butanoate is sourced from PubChem (CID 54409186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).