C13H12F2O3 — CID 10083633
ethyl (2E)-2-[(3,5-difluorophenyl)methylidene]-3-oxobutanoate (PubChem CID 10083633) has the molecular formula C13H12F2O3 and a molecular weight of 254.23 g/mol. Its IUPAC name is ethyl (2E)-2-[(3,5-difluorophenyl)methylidene]-3-oxobutanoate.
| Compound Name | ethyl (2E)-2-[(3,5-difluorophenyl)methylidene]-3-oxobutanoate |
|---|---|
| PubChem CID | 10083633 |
| Molecular Formula | C13H12F2O3 |
| Molecular Weight | 254.23 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | ethyl (2E)-2-[(3,5-difluorophenyl)methylidene]-3-oxobutanoate |
| SMILES | CCOC(=O)/C(=C/c1cc(F)cc(F)c1)C(C)=O |
| InChI | InChI=1S/C13H12F2O3/c1-3-18-13(17)12(8(2)16)6-9-4-10(14)7-11(15)5-9/h4-7H,3H2,1-2H3/b12-6+ |
| InChIKey | ZWWSYJNABICALB-WUXMJOGZSA-N |
| XLogP | 2.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|