C13H9F5O3 — CID 22167912
ethyl (2Z)-3-oxo-2-[(2,3,4,5,6-pentafluorophenyl)methylidene]butanoate (PubChem CID 22167912) has the molecular formula C13H9F5O3 and a molecular weight of 308.20 g/mol. Its IUPAC name is ethyl (2Z)-3-oxo-2-[(2,3,4,5,6-pentafluorophenyl)methylidene]butanoate.
| Compound Name | ethyl (2Z)-3-oxo-2-[(2,3,4,5,6-pentafluorophenyl)methylidene]butanoate |
|---|---|
| PubChem CID | 22167912 |
| Molecular Formula | C13H9F5O3 |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | ethyl (2Z)-3-oxo-2-[(2,3,4,5,6-pentafluorophenyl)methylidene]butanoate |
| SMILES | CCOC(=O)/C(=C\c1c(F)c(F)c(F)c(F)c1F)C(C)=O |
| InChI | InChI=1S/C13H9F5O3/c1-3-21-13(20)6(5(2)19)4-7-8(14)10(16)12(18)11(17)9(7)15/h4H,3H2,1-2H3/b6-4- |
| InChIKey | VTNIZJLGIAOVQT-XQRVVYSFSA-N |
| XLogP | 2.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|