C10H8F3NO2 — CID 59569810
N-[3-formyl-5-(trifluoromethyl)phenyl]acetamide (PubChem CID 59569810) has the molecular formula C10H8F3NO2 and a molecular weight of 231.17 g/mol. Its IUPAC name is N-[3-formyl-5-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[3-formyl-5-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 59569810 |
| Molecular Formula | C10H8F3NO2 |
| Molecular Weight | 231.17 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | N-[3-formyl-5-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(C=O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H8F3NO2/c1-6(16)14-9-3-7(5-15)2-8(4-9)10(11,12)13/h2-5H,1H3,(H,14,16) |
| InChIKey | XAWFKFNVXBBHPZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.17 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|