C12H13F3N4O3 — CID 75398204
N-[3-[[carbamoyl(methyl)amino]carbamoyl]-5-(trifluoromethyl)phenyl]acetamide (PubChem CID 75398204) has the molecular formula C12H13F3N4O3 and a molecular weight of 318.26 g/mol. Its IUPAC name is N-[3-[[carbamoyl(methyl)amino]carbamoyl]-5-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[3-[[carbamoyl(methyl)amino]carbamoyl]-5-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 75398204 |
| Molecular Formula | C12H13F3N4O3 |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | N-[3-[[carbamoyl(methyl)amino]carbamoyl]-5-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(C(=O)NN(C)C(N)=O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3N4O3/c1-6(20)17-9-4-7(3-8(5-9)12(13,14)15)10(21)18-19(2)11(16)22/h3-5H,1-2H3,(H2,16,22)(H,17,20)(H,18,21) |
| InChIKey | GODLBQZHZSOAMX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|