C16H14F6N2O — CID 2819446
(2E)-2-[[3,5-bis(trifluoromethyl)anilino]methylidene]-4,4-dimethyl-3-oxopentanenitrile (PubChem CID 2819446) has the molecular formula C16H14F6N2O and a molecular weight of 364.29 g/mol. Its IUPAC name is (2E)-2-[[3,5-bis(trifluoromethyl)anilino]methylidene]-4,4-dimethyl-3-oxopentanenitrile.
| Compound Name | (2E)-2-[[3,5-bis(trifluoromethyl)anilino]methylidene]-4,4-dimethyl-3-oxopentanenitrile |
|---|---|
| PubChem CID | 2819446 |
| Molecular Formula | C16H14F6N2O |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | (2E)-2-[[3,5-bis(trifluoromethyl)anilino]methylidene]-4,4-dimethyl-3-oxopentanenitrile |
| SMILES | CC(C)(C)C(=O)/C(C#N)=C/Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H14F6N2O/c1-14(2,3)13(25)9(7-23)8-24-12-5-10(15(17,18)19)4-11(6-12)16(20,21)22/h4-6,8,24H,1-3H3/b9-8+ |
| InChIKey | XXBMPIGTVYBRKO-CMDGGOBGSA-N |
| XLogP | 5.16 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|