C12H8F6N2O2S — CID 134100309
(E)-3-[3,5-bis(trifluoromethyl)anilino]-2-methylsulfonylprop-2-enenitrile (PubChem CID 134100309) has the molecular formula C12H8F6N2O2S and a molecular weight of 358.26 g/mol. Its IUPAC name is (E)-3-[3,5-bis(trifluoromethyl)anilino]-2-methylsulfonylprop-2-enenitrile.
| Compound Name | (E)-3-[3,5-bis(trifluoromethyl)anilino]-2-methylsulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 134100309 |
| Molecular Formula | C12H8F6N2O2S |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | (E)-3-[3,5-bis(trifluoromethyl)anilino]-2-methylsulfonylprop-2-enenitrile |
| SMILES | CS(=O)(=O)/C(C#N)=C/Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H8F6N2O2S/c1-23(21,22)10(5-19)6-20-9-3-7(11(13,14)15)2-8(4-9)12(16,17)18/h2-4,6,20H,1H3/b10-6+ |
| InChIKey | IRIDBHLOJKKXQN-UXBLZVDNSA-N |
| XLogP | 3.55 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|