C18H11ClF6N2O2S — CID 2819492
(E)-3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-2-(4-chlorophenyl)sulfonylprop-2-enenitrile (PubChem CID 2819492) has the molecular formula C18H11ClF6N2O2S and a molecular weight of 468.81 g/mol. Its IUPAC name is (E)-3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-2-(4-chlorophenyl)sulfonylprop-2-enenitrile.
| Compound Name | (E)-3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-2-(4-chlorophenyl)sulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 2819492 |
| Molecular Formula | C18H11ClF6N2O2S |
| Molecular Weight | 468.81 g/mol |
| Exact Mass | 468.01 |
| IUPAC Name | (E)-3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-2-(4-chlorophenyl)sulfonylprop-2-enenitrile |
| SMILES | N#C/C(=C\NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H11ClF6N2O2S/c19-14-1-3-15(4-2-14)30(28,29)16(8-26)10-27-9-11-5-12(17(20,21)22)7-13(6-11)18(23,24)25/h1-7,10,27H,9H2/b16-10+ |
| InChIKey | BVQFXTHXPRKDGZ-MHWRWJLKSA-N |
| XLogP | 5.31 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.81 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|