C17H23ClN2O2S — CID 6047608
(E)-2-(4-chlorophenyl)sulfonyl-3-(2,4,4-trimethylpentan-2-ylamino)prop-2-enenitrile (PubChem CID 6047608) has the molecular formula C17H23ClN2O2S and a molecular weight of 354.90 g/mol. Its IUPAC name is (E)-2-(4-chlorophenyl)sulfonyl-3-(2,4,4-trimethylpentan-2-ylamino)prop-2-enenitrile.
| Compound Name | (E)-2-(4-chlorophenyl)sulfonyl-3-(2,4,4-trimethylpentan-2-ylamino)prop-2-enenitrile |
|---|---|
| PubChem CID | 6047608 |
| Molecular Formula | C17H23ClN2O2S |
| Molecular Weight | 354.90 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | (E)-2-(4-chlorophenyl)sulfonyl-3-(2,4,4-trimethylpentan-2-ylamino)prop-2-enenitrile |
| SMILES | CC(C)(C)CC(C)(C)N/C=C(\C#N)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H23ClN2O2S/c1-16(2,3)12-17(4,5)20-11-15(10-19)23(21,22)14-8-6-13(18)7-9-14/h6-9,11,20H,12H2,1-5H3/b15-11+ |
| InChIKey | ZFVMLIJMNCGMIN-RVDMUPIBSA-N |
| XLogP | 4.28 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.90 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|