C11H10ClNO3S — CID 5180355
2-(4-chlorophenyl)sulfonyl-3-ethoxyprop-2-enenitrile (PubChem CID 5180355) has the molecular formula C11H10ClNO3S and a molecular weight of 271.73 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-3-ethoxyprop-2-enenitrile.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-3-ethoxyprop-2-enenitrile |
|---|---|
| PubChem CID | 5180355 |
| Molecular Formula | C11H10ClNO3S |
| Molecular Weight | 271.73 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-3-ethoxyprop-2-enenitrile |
| SMILES | CCOC=C(C#N)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H10ClNO3S/c1-2-16-8-11(7-13)17(14,15)10-5-3-9(12)4-6-10/h3-6,8H,2H2,1H3 |
| InChIKey | SUWQYQRJDNCPOP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.73 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|