C14H16ClN3O2S — CID 3842329
2-(4-chlorophenyl)sulfonyl-3-(piperidin-1-ylamino)prop-2-enenitrile (PubChem CID 3842329) has the molecular formula C14H16ClN3O2S and a molecular weight of 325.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-3-(piperidin-1-ylamino)prop-2-enenitrile.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-3-(piperidin-1-ylamino)prop-2-enenitrile |
|---|---|
| PubChem CID | 3842329 |
| Molecular Formula | C14H16ClN3O2S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-3-(piperidin-1-ylamino)prop-2-enenitrile |
| SMILES | N#CC(=CNN1CCCCC1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H16ClN3O2S/c15-12-4-6-13(7-5-12)21(19,20)14(10-16)11-17-18-8-2-1-3-9-18/h4-7,11,17H,1-3,8-9H2 |
| InChIKey | FMTGROJWCGCPJI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|