C16H9BrF3NO4S — CID 70240007
(Z)-3-(3-bromo-4,5-dihydroxyphenyl)-2-[4-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile (PubChem CID 70240007) has the molecular formula C16H9BrF3NO4S and a molecular weight of 448.22 g/mol. Its IUPAC name is (Z)-3-(3-bromo-4,5-dihydroxyphenyl)-2-[4-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile.
| Compound Name | (Z)-3-(3-bromo-4,5-dihydroxyphenyl)-2-[4-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 70240007 |
| Molecular Formula | C16H9BrF3NO4S |
| Molecular Weight | 448.22 g/mol |
| Exact Mass | 446.94 |
| IUPAC Name | (Z)-3-(3-bromo-4,5-dihydroxyphenyl)-2-[4-(trifluoromethyl)phenyl]sulfonylprop-2-enenitrile |
| SMILES | N#C/C(=C/c1cc(O)c(O)c(Br)c1)S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H9BrF3NO4S/c17-13-6-9(7-14(22)15(13)23)5-12(8-21)26(24,25)11-3-1-10(2-4-11)16(18,19)20/h1-7,22-23H/b12-5- |
| InChIKey | ORMVLUZSBLMALD-XGICHPGQSA-N |
| XLogP | 4.22 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.22 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|