C19H19BrN2O4S — CID 22000622
(E)-2-(3-bromo-4,5-dihydroxyphenyl)-1-cyano-N-(4-phenylbutyl)ethenesulfonamide (PubChem CID 22000622) has the molecular formula C19H19BrN2O4S and a molecular weight of 451.34 g/mol. Its IUPAC name is (E)-2-(3-bromo-4,5-dihydroxyphenyl)-1-cyano-N-(4-phenylbutyl)ethenesulfonamide.
| Compound Name | (E)-2-(3-bromo-4,5-dihydroxyphenyl)-1-cyano-N-(4-phenylbutyl)ethenesulfonamide |
|---|---|
| PubChem CID | 22000622 |
| Molecular Formula | C19H19BrN2O4S |
| Molecular Weight | 451.34 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | (E)-2-(3-bromo-4,5-dihydroxyphenyl)-1-cyano-N-(4-phenylbutyl)ethenesulfonamide |
| SMILES | N#C/C(=C\c1cc(O)c(O)c(Br)c1)S(=O)(=O)NCCCCc1ccccc1 |
| InChI | InChI=1S/C19H19BrN2O4S/c20-17-11-15(12-18(23)19(17)24)10-16(13-21)27(25,26)22-9-5-4-8-14-6-2-1-3-7-14/h1-3,6-7,10-12,22-24H,4-5,8-9H2/b16-10+ |
| InChIKey | YOQKJIRRKOAOJZ-MHWRWJLKSA-N |
| XLogP | 3.67 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|