C20H14BrN3O3S — CID 146205778
(E)-N-(4-benzyl-1,3-thiazol-2-yl)-3-(3-bromo-4,5-dihydroxyphenyl)-2-cyanoprop-2-enamide (PubChem CID 146205778) has the molecular formula C20H14BrN3O3S and a molecular weight of 456.32 g/mol. Its IUPAC name is (E)-N-(4-benzyl-1,3-thiazol-2-yl)-3-(3-bromo-4,5-dihydroxyphenyl)-2-cyanoprop-2-enamide.
| Compound Name | (E)-N-(4-benzyl-1,3-thiazol-2-yl)-3-(3-bromo-4,5-dihydroxyphenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 146205778 |
| Molecular Formula | C20H14BrN3O3S |
| Molecular Weight | 456.32 g/mol |
| Exact Mass | 454.99 |
| IUPAC Name | (E)-N-(4-benzyl-1,3-thiazol-2-yl)-3-(3-bromo-4,5-dihydroxyphenyl)-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C\c1cc(O)c(O)c(Br)c1)C(=O)Nc1nc(Cc2ccccc2)cs1 |
| InChI | InChI=1S/C20H14BrN3O3S/c21-16-8-13(9-17(25)18(16)26)6-14(10-22)19(27)24-20-23-15(11-28-20)7-12-4-2-1-3-5-12/h1-6,8-9,11,25-26H,7H2,(H,23,24,27)/b14-6+ |
| InChIKey | XSBROJMXYQTWKU-MKMNVTDBSA-N |
| XLogP | 4.45 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.32 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|