C23H20BrN3O3S — CID 170913774
(Z)-3-[3-bromo-4-[2-(4-methylphenoxy)ethoxy]phenyl]-2-cyano-N-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 170913774) has the molecular formula C23H20BrN3O3S and a molecular weight of 498.40 g/mol. Its IUPAC name is (Z)-3-[3-bromo-4-[2-(4-methylphenoxy)ethoxy]phenyl]-2-cyano-N-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-3-[3-bromo-4-[2-(4-methylphenoxy)ethoxy]phenyl]-2-cyano-N-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170913774 |
| Molecular Formula | C23H20BrN3O3S |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 497.04 |
| IUPAC Name | (Z)-3-[3-bromo-4-[2-(4-methylphenoxy)ethoxy]phenyl]-2-cyano-N-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | Cc1ccc(OCCOc2ccc(/C=C(/C#N)C(=O)Nc3nc(C)cs3)cc2Br)cc1 |
| InChI | InChI=1S/C23H20BrN3O3S/c1-15-3-6-19(7-4-15)29-9-10-30-21-8-5-17(12-20(21)24)11-18(13-25)22(28)27-23-26-16(2)14-31-23/h3-8,11-12,14H,9-10H2,1-2H3,(H,26,27,28)/b18-11- |
| InChIKey | YASPJTINOAZVLF-WQRHYEAKSA-N |
| XLogP | 5.53 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|