C24H22ClN3O4S — CID 170913615
(Z)-3-[3-chloro-4-[2-(2-methoxy-4-methylphenoxy)ethoxy]phenyl]-2-cyano-N-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 170913615) has the molecular formula C24H22ClN3O4S and a molecular weight of 483.98 g/mol. Its IUPAC name is (Z)-3-[3-chloro-4-[2-(2-methoxy-4-methylphenoxy)ethoxy]phenyl]-2-cyano-N-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-3-[3-chloro-4-[2-(2-methoxy-4-methylphenoxy)ethoxy]phenyl]-2-cyano-N-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170913615 |
| Molecular Formula | C24H22ClN3O4S |
| Molecular Weight | 483.98 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | (Z)-3-[3-chloro-4-[2-(2-methoxy-4-methylphenoxy)ethoxy]phenyl]-2-cyano-N-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | COc1cc(C)ccc1OCCOc1ccc(/C=C(/C#N)C(=O)Nc2nc(C)cs2)cc1Cl |
| InChI | InChI=1S/C24H22ClN3O4S/c1-15-4-6-21(22(10-15)30-3)32-9-8-31-20-7-5-17(12-19(20)25)11-18(13-26)23(29)28-24-27-16(2)14-33-24/h4-7,10-12,14H,8-9H2,1-3H3,(H,27,28,29)/b18-11- |
| InChIKey | KQIJFVFCBGVTFD-WQRHYEAKSA-N |
| XLogP | 5.43 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.98 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|