C21H19ClN4O2S — CID 170914422
(Z)-3-[1-(3-chloro-4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 170914422) has the molecular formula C21H19ClN4O2S and a molecular weight of 426.93 g/mol. Its IUPAC name is (Z)-3-[1-(3-chloro-4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-3-[1-(3-chloro-4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170914422 |
| Molecular Formula | C21H19ClN4O2S |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | (Z)-3-[1-(3-chloro-4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | COc1ccc(-n2c(C)cc(/C=C(/C#N)C(=O)Nc3nc(C)cs3)c2C)cc1Cl |
| InChI | InChI=1S/C21H19ClN4O2S/c1-12-11-29-21(24-12)25-20(27)16(10-23)8-15-7-13(2)26(14(15)3)17-5-6-19(28-4)18(22)9-17/h5-9,11H,1-4H3,(H,24,25,27)/b16-8- |
| InChIKey | HISUVROPVFCUCK-PXNMLYILSA-N |
| XLogP | 5.07 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|