C19H12BrN3O3S — CID 146190187
(E)-N-(5-bromo-4-phenyl-1,3-thiazol-2-yl)-2-cyano-3-(3,4-dihydroxyphenyl)prop-2-enamide (PubChem CID 146190187) has the molecular formula C19H12BrN3O3S and a molecular weight of 442.29 g/mol. Its IUPAC name is (E)-N-(5-bromo-4-phenyl-1,3-thiazol-2-yl)-2-cyano-3-(3,4-dihydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(5-bromo-4-phenyl-1,3-thiazol-2-yl)-2-cyano-3-(3,4-dihydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 146190187 |
| Molecular Formula | C19H12BrN3O3S |
| Molecular Weight | 442.29 g/mol |
| Exact Mass | 440.98 |
| IUPAC Name | (E)-N-(5-bromo-4-phenyl-1,3-thiazol-2-yl)-2-cyano-3-(3,4-dihydroxyphenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(O)c(O)c1)C(=O)Nc1nc(-c2ccccc2)c(Br)s1 |
| InChI | InChI=1S/C19H12BrN3O3S/c20-17-16(12-4-2-1-3-5-12)22-19(27-17)23-18(26)13(10-21)8-11-6-7-14(24)15(25)9-11/h1-9,24-25H,(H,22,23,26)/b13-8+ |
| InChIKey | KAAAOKDHKRYEJS-MDWZMJQESA-N |
| XLogP | 4.53 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.29 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|