C17H11N5O3S — CID 146205580
(E)-2-cyano-3-(3,4-dihydroxyphenyl)-N-(5-pyrazin-2-yl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 146205580) has the molecular formula C17H11N5O3S and a molecular weight of 365.37 g/mol. Its IUPAC name is (E)-2-cyano-3-(3,4-dihydroxyphenyl)-N-(5-pyrazin-2-yl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(3,4-dihydroxyphenyl)-N-(5-pyrazin-2-yl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 146205580 |
| Molecular Formula | C17H11N5O3S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | (E)-2-cyano-3-(3,4-dihydroxyphenyl)-N-(5-pyrazin-2-yl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(O)c(O)c1)C(=O)Nc1ncc(-c2cnccn2)s1 |
| InChI | InChI=1S/C17H11N5O3S/c18-7-11(5-10-1-2-13(23)14(24)6-10)16(25)22-17-21-9-15(26-17)12-8-19-3-4-20-12/h1-6,8-9,23-24H,(H,21,22,25)/b11-5+ |
| InChIKey | DKDKJTXCDTZJER-VZUCSPMQSA-N |
| XLogP | 2.56 |
| TPSA | 132.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|