C18H18N2O4S — CID 22000632
(E)-N-benzyl-1-cyano-2-(3-ethoxy-4-hydroxyphenyl)ethenesulfonamide (PubChem CID 22000632) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is (E)-N-benzyl-1-cyano-2-(3-ethoxy-4-hydroxyphenyl)ethenesulfonamide.
| Compound Name | (E)-N-benzyl-1-cyano-2-(3-ethoxy-4-hydroxyphenyl)ethenesulfonamide |
|---|---|
| PubChem CID | 22000632 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | (E)-N-benzyl-1-cyano-2-(3-ethoxy-4-hydroxyphenyl)ethenesulfonamide |
| SMILES | CCOc1cc(/C=C(\C#N)S(=O)(=O)NCc2ccccc2)ccc1O |
| InChI | InChI=1S/C18H18N2O4S/c1-2-24-18-11-15(8-9-17(18)21)10-16(12-19)25(22,23)20-13-14-6-4-3-5-7-14/h3-11,20-21H,2,13H2,1H3/b16-10+ |
| InChIKey | WICIHKSGCYPGAJ-MHWRWJLKSA-N |
| XLogP | 2.77 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|