C15H13ClN2O2S2 — CID 3764003
2-[(4-chlorophenyl)methylsulfonyl]-3-(thiophen-2-ylmethylamino)prop-2-enenitrile (PubChem CID 3764003) has the molecular formula C15H13ClN2O2S2 and a molecular weight of 352.87 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfonyl]-3-(thiophen-2-ylmethylamino)prop-2-enenitrile.
| Compound Name | 2-[(4-chlorophenyl)methylsulfonyl]-3-(thiophen-2-ylmethylamino)prop-2-enenitrile |
|---|---|
| PubChem CID | 3764003 |
| Molecular Formula | C15H13ClN2O2S2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfonyl]-3-(thiophen-2-ylmethylamino)prop-2-enenitrile |
| SMILES | N#CC(=CNCc1cccs1)S(=O)(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H13ClN2O2S2/c16-13-5-3-12(4-6-13)11-22(19,20)15(8-17)10-18-9-14-2-1-7-21-14/h1-7,10,18H,9,11H2 |
| InChIKey | YUAARAHLBFPBLF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|