C17H9F7N2O2S — CID 3831652
3-[3,5-bis(trifluoromethyl)anilino]-2-(4-fluorophenyl)sulfonylprop-2-enenitrile (PubChem CID 3831652) has the molecular formula C17H9F7N2O2S and a molecular weight of 438.32 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)anilino]-2-(4-fluorophenyl)sulfonylprop-2-enenitrile.
| Compound Name | 3-[3,5-bis(trifluoromethyl)anilino]-2-(4-fluorophenyl)sulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 3831652 |
| Molecular Formula | C17H9F7N2O2S |
| Molecular Weight | 438.32 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)anilino]-2-(4-fluorophenyl)sulfonylprop-2-enenitrile |
| SMILES | N#CC(=CNc1cc(C(F)(F)F)cc(C(F)(F)F)c1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H9F7N2O2S/c18-12-1-3-14(4-2-12)29(27,28)15(8-25)9-26-13-6-10(16(19,20)21)5-11(7-13)17(22,23)24/h1-7,9,26H |
| InChIKey | HBMNSASRXTTWEM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.32 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|