C16H17N5O — CID 53413452
4,4-dimethyl-3-oxo-2-[[4-(1H-1,2,4-triazol-5-yl)anilino]methylidene]pentanenitrile (PubChem CID 53413452) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is 4,4-dimethyl-3-oxo-2-[[4-(1H-1,2,4-triazol-5-yl)anilino]methylidene]pentanenitrile.
| Compound Name | 4,4-dimethyl-3-oxo-2-[[4-(1H-1,2,4-triazol-5-yl)anilino]methylidene]pentanenitrile |
|---|---|
| PubChem CID | 53413452 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 4,4-dimethyl-3-oxo-2-[[4-(1H-1,2,4-triazol-5-yl)anilino]methylidene]pentanenitrile |
| SMILES | CC(C)(C)C(=O)C(C#N)=CNc1ccc(-c2ncn[nH]2)cc1 |
| InChI | InChI=1S/C16H17N5O/c1-16(2,3)14(22)12(8-17)9-18-13-6-4-11(5-7-13)15-19-10-20-21-15/h4-7,9-10,18H,1-3H3,(H,19,20,21) |
| InChIKey | OEGJZOGPZBPNMF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|