C16H12Cl2O2S2 — CID 134695129
methyl 2,3-bis[(4-chlorophenyl)sulfanyl]prop-2-enoate (PubChem CID 134695129) has the molecular formula C16H12Cl2O2S2 and a molecular weight of 371.31 g/mol. Its IUPAC name is methyl 2,3-bis[(4-chlorophenyl)sulfanyl]prop-2-enoate.
| Compound Name | methyl 2,3-bis[(4-chlorophenyl)sulfanyl]prop-2-enoate |
|---|---|
| PubChem CID | 134695129 |
| Molecular Formula | C16H12Cl2O2S2 |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | methyl 2,3-bis[(4-chlorophenyl)sulfanyl]prop-2-enoate |
| SMILES | COC(=O)C(=CSc1ccc(Cl)cc1)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H12Cl2O2S2/c1-20-16(19)15(22-14-8-4-12(18)5-9-14)10-21-13-6-2-11(17)3-7-13/h2-10H,1H3 |
| InChIKey | AOWYRGZKSBSYTE-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|