About 1-chloro-4-[(1E,3E)-4-methoxy-2-methylbuta-1,3-dienyl]sulfanylbenzene
1-chloro-4-[(1E,3E)-4-methoxy-2-methylbuta-1,3-dienyl]sulfanylbenzene (PubChem CID 10705249) has the molecular formula C12H13ClOS
and a molecular weight of 240.76 g/mol. Its IUPAC name is 1-chloro-4-[(1E,3E)-4-methoxy-2-methylbuta-1,3-dienyl]sulfanylbenzene.
Molecular Properties
| Compound Name | 1-chloro-4-[(1E,3E)-4-methoxy-2-methylbuta-1,3-dienyl]sulfanylbenzene |
| PubChem CID | 10705249 |
| Molecular Formula | C12H13ClOS |
| Molecular Weight | 240.76 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 1-chloro-4-[(1E,3E)-4-methoxy-2-methylbuta-1,3-dienyl]sulfanylbenzene |
| SMILES | CO/C=C/C(C)=C/Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13ClOS/c1-10(7-8-14-2)9-15-12-5-3-11(13)4-6-12/h3-9H,1-2H3/b8-7+,10-9+ |
| InChIKey | VVKIHCJDTPCDII-XBLVEGMJSA-N |
| XLogP | 4.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.76 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-[(1E,3E)-4-methoxy-2-methylbuta-1,3-dienyl]sulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-[(1E,3E)-4-methoxy-2-methylbuta-1,3-dienyl]sulfanylbenzene?
The IUPAC name of 1-chloro-4-[(1E,3E)-4-methoxy-2-methylbuta-1,3-dienyl]sulfanylbenzene (CID 10705249) is 1-chloro-4-[(1E,3E)-4-methoxy-2-methylbuta-1,3-dienyl]sulfanylbenzene.
What is the SMILES notation for 1-chloro-4-[(1E,3E)-4-methoxy-2-methylbuta-1,3-dienyl]sulfanylbenzene?
The canonical SMILES for 1-chloro-4-[(1E,3E)-4-methoxy-2-methylbuta-1,3-dienyl]sulfanylbenzene is CO/C=C/C(C)=C/Sc1ccc(Cl)cc1.
What is the InChIKey of 1-chloro-4-[(1E,3E)-4-methoxy-2-methylbuta-1,3-dienyl]sulfanylbenzene?
The InChIKey is VVKIHCJDTPCDII-XBLVEGMJSA-N. The full InChI is InChI=1S/C12H13ClOS/c1-10(7-8-14-2)9-15-12-5-3-11(13)4-6-12/h3-9H,1-2H3/b8-7+,10-9+.
What are the key properties of 1-chloro-4-[(1E,3E)-4-methoxy-2-methylbuta-1,3-dienyl]sulfanylbenzene?
1-chloro-4-[(1E,3E)-4-methoxy-2-methylbuta-1,3-dienyl]sulfanylbenzene has a molecular weight of 240.76 g/mol, XLogP of 4.50, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-[(1E,3E)-4-methoxy-2-methylbuta-1,3-dienyl]sulfanylbenzene is sourced from PubChem (CID 10705249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).