C12H13ClOS — CID 10705249
1-chloro-4-[(1E,3E)-4-methoxy-2-methylbuta-1,3-dienyl]sulfanylbenzene (PubChem CID 10705249) has the molecular formula C12H13ClOS and a molecular weight of 240.76 g/mol. Its IUPAC name is 1-chloro-4-[(1E,3E)-4-methoxy-2-methylbuta-1,3-dienyl]sulfanylbenzene.
| Compound Name | 1-chloro-4-[(1E,3E)-4-methoxy-2-methylbuta-1,3-dienyl]sulfanylbenzene |
|---|---|
| PubChem CID | 10705249 |
| Molecular Formula | C12H13ClOS |
| Molecular Weight | 240.76 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 1-chloro-4-[(1E,3E)-4-methoxy-2-methylbuta-1,3-dienyl]sulfanylbenzene |
| SMILES | CO/C=C/C(C)=C/Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13ClOS/c1-10(7-8-14-2)9-15-12-5-3-11(13)4-6-12/h3-9H,1-2H3/b8-7+,10-9+ |
| InChIKey | VVKIHCJDTPCDII-XBLVEGMJSA-N |
| XLogP | 4.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.76 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|