About (4-chlorophenyl)sulfanyl acetate
(4-chlorophenyl)sulfanyl acetate (PubChem CID 139466888) has the molecular formula C8H7ClO2S
and a molecular weight of 202.66 g/mol. Its IUPAC name is (4-chlorophenyl)sulfanyl acetate.
Molecular Properties
| Compound Name | (4-chlorophenyl)sulfanyl acetate |
| PubChem CID | 139466888 |
| Molecular Formula | C8H7ClO2S |
| Molecular Weight | 202.66 g/mol |
| Exact Mass | 201.99 |
| IUPAC Name | (4-chlorophenyl)sulfanyl acetate |
| SMILES | CC(=O)OSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H7ClO2S/c1-6(10)11-12-8-4-2-7(9)3-5-8/h2-5H,1H3 |
| InChIKey | MOFUWRSFLHNZRM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.66 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl)sulfanyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)sulfanyl acetate?
The IUPAC name of (4-chlorophenyl)sulfanyl acetate (CID 139466888) is (4-chlorophenyl)sulfanyl acetate.
What is the SMILES notation for (4-chlorophenyl)sulfanyl acetate?
The canonical SMILES for (4-chlorophenyl)sulfanyl acetate is CC(=O)OSc1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenyl)sulfanyl acetate?
The InChIKey is MOFUWRSFLHNZRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClO2S/c1-6(10)11-12-8-4-2-7(9)3-5-8/h2-5H,1H3.
What are the key properties of (4-chlorophenyl)sulfanyl acetate?
(4-chlorophenyl)sulfanyl acetate has a molecular weight of 202.66 g/mol, XLogP of 2.91, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)sulfanyl acetate is sourced from PubChem (CID 139466888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).