About (4-chlorophenyl) thiohypobromite
(4-chlorophenyl) thiohypobromite (PubChem CID 12623145) has the molecular formula C6H4BrClS
and a molecular weight of 223.52 g/mol. Its IUPAC name is (4-chlorophenyl) thiohypobromite.
Molecular Properties
| Compound Name | (4-chlorophenyl) thiohypobromite |
| PubChem CID | 12623145 |
| Molecular Formula | C6H4BrClS |
| Molecular Weight | 223.52 g/mol |
| Exact Mass | 221.89 |
| IUPAC Name | (4-chlorophenyl) thiohypobromite |
| SMILES | Clc1ccc(SBr)cc1 |
| InChI | InChI=1S/C6H4BrClS/c7-9-6-3-1-5(8)2-4-6/h1-4H |
| InChIKey | UKAGSGSUVSYCMD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4-chlorophenyl) thiohypobromite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl) thiohypobromite?
The IUPAC name of (4-chlorophenyl) thiohypobromite (CID 12623145) is (4-chlorophenyl) thiohypobromite.
What is the SMILES notation for (4-chlorophenyl) thiohypobromite?
The canonical SMILES for (4-chlorophenyl) thiohypobromite is Clc1ccc(SBr)cc1.
What is the InChIKey of (4-chlorophenyl) thiohypobromite?
The InChIKey is UKAGSGSUVSYCMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrClS/c7-9-6-3-1-5(8)2-4-6/h1-4H.
What are the key properties of (4-chlorophenyl) thiohypobromite?
(4-chlorophenyl) thiohypobromite has a molecular weight of 223.52 g/mol, XLogP of 3.74, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl) thiohypobromite is sourced from PubChem (CID 12623145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).