C9H8Cl4S — CID 13419823
1-chloro-4-(1,2,2-trichloropropylsulfanyl)benzene (PubChem CID 13419823) has the molecular formula C9H8Cl4S and a molecular weight of 290.04 g/mol. Its IUPAC name is 1-chloro-4-(1,2,2-trichloropropylsulfanyl)benzene.
| Compound Name | 1-chloro-4-(1,2,2-trichloropropylsulfanyl)benzene |
|---|---|
| PubChem CID | 13419823 |
| Molecular Formula | C9H8Cl4S |
| Molecular Weight | 290.04 g/mol |
| Exact Mass | 287.91 |
| IUPAC Name | 1-chloro-4-(1,2,2-trichloropropylsulfanyl)benzene |
| SMILES | CC(Cl)(Cl)C(Cl)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H8Cl4S/c1-9(12,13)8(11)14-7-4-2-6(10)3-5-7/h2-5,8H,1H3 |
| InChIKey | KZGUIHDGZPAPKA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.04 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|