C10H6ClF7S — CID 11151555
1-chloro-4-(1,2,2,3,3,4,4-heptafluorobutylsulfanyl)benzene (PubChem CID 11151555) has the molecular formula C10H6ClF7S and a molecular weight of 326.66 g/mol. Its IUPAC name is 1-chloro-4-(1,2,2,3,3,4,4-heptafluorobutylsulfanyl)benzene.
| Compound Name | 1-chloro-4-(1,2,2,3,3,4,4-heptafluorobutylsulfanyl)benzene |
|---|---|
| PubChem CID | 11151555 |
| Molecular Formula | C10H6ClF7S |
| Molecular Weight | 326.66 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | 1-chloro-4-(1,2,2,3,3,4,4-heptafluorobutylsulfanyl)benzene |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H6ClF7S/c11-5-1-3-6(4-2-5)19-8(14)10(17,18)9(15,16)7(12)13/h1-4,7-8H |
| InChIKey | LJYDYAGGMGEFAK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.66 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|