C22H22Cl2F6S2 — CID 101365213
1-chloro-4-[9-(4-chlorophenyl)sulfanyl-1,1,2,9,10,10-hexafluorodecan-2-yl]sulfanylbenzene (PubChem CID 101365213) has the molecular formula C22H22Cl2F6S2 and a molecular weight of 535.45 g/mol. Its IUPAC name is 1-chloro-4-[9-(4-chlorophenyl)sulfanyl-1,1,2,9,10,10-hexafluorodecan-2-yl]sulfanylbenzene.
| Compound Name | 1-chloro-4-[9-(4-chlorophenyl)sulfanyl-1,1,2,9,10,10-hexafluorodecan-2-yl]sulfanylbenzene |
|---|---|
| PubChem CID | 101365213 |
| Molecular Formula | C22H22Cl2F6S2 |
| Molecular Weight | 535.45 g/mol |
| Exact Mass | 534.04 |
| IUPAC Name | 1-chloro-4-[9-(4-chlorophenyl)sulfanyl-1,1,2,9,10,10-hexafluorodecan-2-yl]sulfanylbenzene |
| SMILES | FC(F)C(F)(CCCCCCC(F)(Sc1ccc(Cl)cc1)C(F)F)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H22Cl2F6S2/c23-15-5-9-17(10-6-15)31-21(29,19(25)26)13-3-1-2-4-14-22(30,20(27)28)32-18-11-7-16(24)8-12-18/h5-12,19-20H,1-4,13-14H2 |
| InChIKey | XQWGOAPMPWYKKJ-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.45 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|