About 4-chlorobenzenethiol;fluoroform
4-chlorobenzenethiol;fluoroform (PubChem CID 174810562) has the molecular formula C7H6ClF3S
and a molecular weight of 214.64 g/mol. Its IUPAC name is 4-chlorobenzenethiol;fluoroform.
Molecular Properties
| Compound Name | 4-chlorobenzenethiol;fluoroform |
| PubChem CID | 174810562 |
| Molecular Formula | C7H6ClF3S |
| Molecular Weight | 214.64 g/mol |
| Exact Mass | 213.98 |
| IUPAC Name | 4-chlorobenzenethiol;fluoroform |
| SMILES | FC(F)F.Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C6H5ClS.CHF3/c7-5-1-3-6(8)4-2-5;2-1(3)4/h1-4,8H;1H |
| InChIKey | FTVKLHIJDKCDEC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.64 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-chlorobenzenethiol;fluoroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorobenzenethiol;fluoroform?
The IUPAC name of 4-chlorobenzenethiol;fluoroform (CID 174810562) is 4-chlorobenzenethiol;fluoroform.
What is the SMILES notation for 4-chlorobenzenethiol;fluoroform?
The canonical SMILES for 4-chlorobenzenethiol;fluoroform is FC(F)F.Sc1ccc(Cl)cc1.
What is the InChIKey of 4-chlorobenzenethiol;fluoroform?
The InChIKey is FTVKLHIJDKCDEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClS.CHF3/c7-5-1-3-6(8)4-2-5;2-1(3)4/h1-4,8H;1H.
What are the key properties of 4-chlorobenzenethiol;fluoroform?
4-chlorobenzenethiol;fluoroform has a molecular weight of 214.64 g/mol, XLogP of 3.81, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorobenzenethiol;fluoroform is sourced from PubChem (CID 174810562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).