About bismuthane;4-chlorobenzenethiol
bismuthane;4-chlorobenzenethiol (PubChem CID 173174465) has the molecular formula C6H8BiClS
and a molecular weight of 356.63 g/mol. Its IUPAC name is bismuthane;4-chlorobenzenethiol.
Molecular Properties
| Compound Name | bismuthane;4-chlorobenzenethiol |
| PubChem CID | 173174465 |
| Molecular Formula | C6H8BiClS |
| Molecular Weight | 356.63 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | bismuthane;4-chlorobenzenethiol |
| SMILES | Sc1ccc(Cl)cc1.[BiH3] |
| InChI | InChI=1S/C6H5ClS.Bi.3H/c7-5-1-3-6(8)4-2-5;;;;/h1-4,8H;;;; |
| InChIKey | VZECIZAOOBEWCV-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.63 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bismuthane;4-chlorobenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bismuthane;4-chlorobenzenethiol?
The IUPAC name of bismuthane;4-chlorobenzenethiol (CID 173174465) is bismuthane;4-chlorobenzenethiol.
What is the SMILES notation for bismuthane;4-chlorobenzenethiol?
The canonical SMILES for bismuthane;4-chlorobenzenethiol is Sc1ccc(Cl)cc1.[BiH3].
What is the InChIKey of bismuthane;4-chlorobenzenethiol?
The InChIKey is VZECIZAOOBEWCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClS.Bi.3H/c7-5-1-3-6(8)4-2-5;;;;/h1-4,8H;;;;.
What are the key properties of bismuthane;4-chlorobenzenethiol?
bismuthane;4-chlorobenzenethiol has a molecular weight of 356.63 g/mol, XLogP of 1.44, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bismuthane;4-chlorobenzenethiol is sourced from PubChem (CID 173174465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).