C9H6BrClF4 — CID 79660642
1-(1-bromo-2,2,3,3-tetrafluoropropyl)-4-chlorobenzene (PubChem CID 79660642) has the molecular formula C9H6BrClF4 and a molecular weight of 305.50 g/mol. Its IUPAC name is 1-(1-bromo-2,2,3,3-tetrafluoropropyl)-4-chlorobenzene.
| Compound Name | 1-(1-bromo-2,2,3,3-tetrafluoropropyl)-4-chlorobenzene |
|---|---|
| PubChem CID | 79660642 |
| Molecular Formula | C9H6BrClF4 |
| Molecular Weight | 305.50 g/mol |
| Exact Mass | 303.93 |
| IUPAC Name | 1-(1-bromo-2,2,3,3-tetrafluoropropyl)-4-chlorobenzene |
| SMILES | FC(F)C(F)(F)C(Br)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H6BrClF4/c10-7(9(14,15)8(12)13)5-1-3-6(11)4-2-5/h1-4,7-8H |
| InChIKey | KLKAGMYMHLQARA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|