C11H9BrF4O2 — CID 79660200
6-(1-bromo-2,2,3,3-tetrafluoropropyl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 79660200) has the molecular formula C11H9BrF4O2 and a molecular weight of 329.09 g/mol. Its IUPAC name is 6-(1-bromo-2,2,3,3-tetrafluoropropyl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-(1-bromo-2,2,3,3-tetrafluoropropyl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 79660200 |
| Molecular Formula | C11H9BrF4O2 |
| Molecular Weight | 329.09 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | 6-(1-bromo-2,2,3,3-tetrafluoropropyl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | FC(F)C(F)(F)C(Br)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C11H9BrF4O2/c12-9(11(15,16)10(13)14)6-1-2-7-8(5-6)18-4-3-17-7/h1-2,5,9-10H,3-4H2 |
| InChIKey | YPAFOJWNPFXAJT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.09 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|