C12H9BrF6O2 — CID 103310700
6-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 103310700) has the molecular formula C12H9BrF6O2 and a molecular weight of 379.09 g/mol. Its IUPAC name is 6-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 103310700 |
| Molecular Formula | C12H9BrF6O2 |
| Molecular Weight | 379.09 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | 6-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | FC(F)(F)C(C(Br)c1ccc2c(c1)OCCO2)C(F)(F)F |
| InChI | InChI=1S/C12H9BrF6O2/c13-9(10(11(14,15)16)12(17,18)19)6-1-2-7-8(5-6)21-4-3-20-7/h1-2,5,9-10H,3-4H2 |
| InChIKey | ZCVANSFAXIWJCJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.09 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|