C11H12ClF3S — CID 86059258
1-chloro-4-(4,4,4-trifluorobutylsulfanylmethyl)benzene (PubChem CID 86059258) has the molecular formula C11H12ClF3S and a molecular weight of 268.73 g/mol. Its IUPAC name is 1-chloro-4-(4,4,4-trifluorobutylsulfanylmethyl)benzene.
| Compound Name | 1-chloro-4-(4,4,4-trifluorobutylsulfanylmethyl)benzene |
|---|---|
| PubChem CID | 86059258 |
| Molecular Formula | C11H12ClF3S |
| Molecular Weight | 268.73 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 1-chloro-4-(4,4,4-trifluorobutylsulfanylmethyl)benzene |
| SMILES | FC(F)(F)CCCSCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H12ClF3S/c12-10-4-2-9(3-5-10)8-16-7-1-6-11(13,14)15/h2-5H,1,6-8H2 |
| InChIKey | NWCZTYVLGZIONL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.73 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|