C14H21ClN2OS — CID 114790479
5-[(4-chlorophenyl)methylsulfanyl]-N'-hydroxy-2,2-dimethylpentanimidamide (PubChem CID 114790479) has the molecular formula C14H21ClN2OS and a molecular weight of 300.85 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methylsulfanyl]-N'-hydroxy-2,2-dimethylpentanimidamide.
| Compound Name | 5-[(4-chlorophenyl)methylsulfanyl]-N'-hydroxy-2,2-dimethylpentanimidamide |
|---|---|
| PubChem CID | 114790479 |
| Molecular Formula | C14H21ClN2OS |
| Molecular Weight | 300.85 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 5-[(4-chlorophenyl)methylsulfanyl]-N'-hydroxy-2,2-dimethylpentanimidamide |
| SMILES | CC(C)(CCCSCc1ccc(Cl)cc1)/C(N)=N/O |
| InChI | InChI=1S/C14H21ClN2OS/c1-14(2,13(16)17-18)8-3-9-19-10-11-4-6-12(15)7-5-11/h4-7,18H,3,8-10H2,1-2H3,(H2,16,17) |
| InChIKey | RDXXBILMTKXFOY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.85 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|