C13H20ClNS — CID 114790761
4-[(4-chlorophenyl)methylsulfanyl]-2,2-dimethylbutan-1-amine (PubChem CID 114790761) has the molecular formula C13H20ClNS and a molecular weight of 257.83 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methylsulfanyl]-2,2-dimethylbutan-1-amine.
| Compound Name | 4-[(4-chlorophenyl)methylsulfanyl]-2,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 114790761 |
| Molecular Formula | C13H20ClNS |
| Molecular Weight | 257.83 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 4-[(4-chlorophenyl)methylsulfanyl]-2,2-dimethylbutan-1-amine |
| SMILES | CC(C)(CN)CCSCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H20ClNS/c1-13(2,10-15)7-8-16-9-11-3-5-12(14)6-4-11/h3-6H,7-10,15H2,1-2H3 |
| InChIKey | QOSSPSFJURXWFS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.83 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|