C11H13ClS — CID 10998347
1-chloro-4-[(E,2R)-pent-3-en-2-yl]sulfanylbenzene (PubChem CID 10998347) has the molecular formula C11H13ClS and a molecular weight of 212.75 g/mol. Its IUPAC name is 1-chloro-4-[(E,2R)-pent-3-en-2-yl]sulfanylbenzene.
| Compound Name | 1-chloro-4-[(E,2R)-pent-3-en-2-yl]sulfanylbenzene |
|---|---|
| PubChem CID | 10998347 |
| Molecular Formula | C11H13ClS |
| Molecular Weight | 212.75 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 1-chloro-4-[(E,2R)-pent-3-en-2-yl]sulfanylbenzene |
| SMILES | C/C=C/[C@@H](C)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H13ClS/c1-3-4-9(2)13-11-7-5-10(12)6-8-11/h3-9H,1-2H3/b4-3+/t9-/m1/s1 |
| InChIKey | CEERERAJUYBHII-CDAZIORVSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.75 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|