C8H6Cl4S2 — CID 21224776
1,4-bis(dichloromethylsulfanyl)benzene (PubChem CID 21224776) has the molecular formula C8H6Cl4S2 and a molecular weight of 308.08 g/mol. Its IUPAC name is 1,4-bis(dichloromethylsulfanyl)benzene.
| Compound Name | 1,4-bis(dichloromethylsulfanyl)benzene |
|---|---|
| PubChem CID | 21224776 |
| Molecular Formula | C8H6Cl4S2 |
| Molecular Weight | 308.08 g/mol |
| Exact Mass | 305.87 |
| IUPAC Name | 1,4-bis(dichloromethylsulfanyl)benzene |
| SMILES | ClC(Cl)Sc1ccc(SC(Cl)Cl)cc1 |
| InChI | InChI=1S/C8H6Cl4S2/c9-7(10)13-5-1-2-6(4-3-5)14-8(11)12/h1-4,7-8H |
| InChIKey | MRMJURLGUJOKLK-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.08 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|