C9H10F2OS — CID 175591763
2,2-difluoro-1-(4-methylphenyl)sulfanylethanol (PubChem CID 175591763) has the molecular formula C9H10F2OS and a molecular weight of 204.24 g/mol. Its IUPAC name is 2,2-difluoro-1-(4-methylphenyl)sulfanylethanol.
| Compound Name | 2,2-difluoro-1-(4-methylphenyl)sulfanylethanol |
|---|---|
| PubChem CID | 175591763 |
| Molecular Formula | C9H10F2OS |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 2,2-difluoro-1-(4-methylphenyl)sulfanylethanol |
| SMILES | Cc1ccc(SC(O)C(F)F)cc1 |
| InChI | InChI=1S/C9H10F2OS/c1-6-2-4-7(5-3-6)13-9(12)8(10)11/h2-5,8-9,12H,1H3 |
| InChIKey | ZUBGPGKEIKCKEF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|