C24H26S3 — CID 10024575
1-[(2R)-1,1-bis[(4-methylphenyl)sulfanyl]propan-2-yl]sulfanyl-4-methylbenzene (PubChem CID 10024575) has the molecular formula C24H26S3 and a molecular weight of 410.67 g/mol. Its IUPAC name is 1-[(2R)-1,1-bis[(4-methylphenyl)sulfanyl]propan-2-yl]sulfanyl-4-methylbenzene.
| Compound Name | 1-[(2R)-1,1-bis[(4-methylphenyl)sulfanyl]propan-2-yl]sulfanyl-4-methylbenzene |
|---|---|
| PubChem CID | 10024575 |
| Molecular Formula | C24H26S3 |
| Molecular Weight | 410.67 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 1-[(2R)-1,1-bis[(4-methylphenyl)sulfanyl]propan-2-yl]sulfanyl-4-methylbenzene |
| SMILES | Cc1ccc(SC(Sc2ccc(C)cc2)[C@@H](C)Sc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H26S3/c1-17-5-11-21(12-6-17)25-20(4)24(26-22-13-7-18(2)8-14-22)27-23-15-9-19(3)10-16-23/h5-16,20,24H,1-4H3/t20-/m1/s1 |
| InChIKey | JFYOECLLTJHRGW-HXUWFJFHSA-N |
| XLogP | 8.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.67 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|