C14H21FO4S — CID 70986865
2-fluoro-3-[2-hydroxy-1-(4-methylphenyl)sulfanylpropoxy]butane-1,4-diol (PubChem CID 70986865) has the molecular formula C14H21FO4S and a molecular weight of 304.38 g/mol. Its IUPAC name is 2-fluoro-3-[2-hydroxy-1-(4-methylphenyl)sulfanylpropoxy]butane-1,4-diol.
| Compound Name | 2-fluoro-3-[2-hydroxy-1-(4-methylphenyl)sulfanylpropoxy]butane-1,4-diol |
|---|---|
| PubChem CID | 70986865 |
| Molecular Formula | C14H21FO4S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2-fluoro-3-[2-hydroxy-1-(4-methylphenyl)sulfanylpropoxy]butane-1,4-diol |
| SMILES | Cc1ccc(SC(OC(CO)C(F)CO)C(C)O)cc1 |
| InChI | InChI=1S/C14H21FO4S/c1-9-3-5-11(6-4-9)20-14(10(2)18)19-13(8-17)12(15)7-16/h3-6,10,12-14,16-18H,7-8H2,1-2H3 |
| InChIKey | RWXVFDYAVMQRGA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|